Wiley SpectraBase; SpectraBase Compound ID=SCLISaHiC6
http://spectrabase.com/compound/SCLISaHiC6 (accessed Jul 11, 2020).

REFERENCE
SpectraBase Compound ID SCLISaHiC6
InChI InChI=1S/C6H9NO/c7-4-5-2-1-3-6(5)8/h5-6,8H,1-3H2/t5-,6+/m0/s1
InChIKey LXEPXMXJJFJNOU-NTSWFWBYSA-N
Mol Weight 111.14 g/mol
Molecular Formula C6H9NO
Exact Mass 111.068414 g/mol
Enantiomer InChIKey LXEPXMXJJFJNOU-RITPCOANSA-N