Wiley SpectraBase; SpectraBase Compound ID=KE9Ad0zRJ8g
http://spectrabase.com/compound/KE9Ad0zRJ8g (accessed Jul 14, 2020).

cis-2-hydroxycyclopentanecarbonitrile
SpectraBase Compound ID KE9Ad0zRJ8g
InChI InChI=1S/C6H9NO/c7-4-5-2-1-3-6(5)8/h5-6,8H,1-3H2/t5-,6-/m0/s1
InChIKey LXEPXMXJJFJNOU-WDSKDSINSA-N
Mol Weight 111.14 g/mol
Molecular Formula C6H9NO
Exact Mass 111.068414 g/mol
Enantiomer InChIKey LXEPXMXJJFJNOU-PHDIDXHHSA-N