Wiley SpectraBase; SpectraBase Compound ID=ANoRjHrRKIx
http://spectrabase.com/compound/ANoRjHrRKIx (accessed Jul 14, 2020).

TRANS-2-HYDROXYCYCLOPENTANEMETHANOL
SpectraBase Compound ID ANoRjHrRKIx
InChI InChI=1S/C6H12O2/c7-4-5-2-1-3-6(5)8/h5-8H,1-4H2/t5-,6+/m0/s1
InChIKey UADBLZFWTJHOJC-NTSWFWBYSA-N
Mol Weight 116.16 g/mol
Molecular Formula C6H12O2
Exact Mass 116.08373 g/mol
Enantiomer InChIKey UADBLZFWTJHOJC-RITPCOANSA-N