Wiley SpectraBase; SpectraBase Compound ID=FJFr80tUFMs
http://spectrabase.com/compound/FJFr80tUFMs (accessed Aug 07, 2020).

(S)-(-)-4,4A,5,6,7,9-HEXAHYDRO-FURO-[2,3-F]-INDOLIZINE-4,7-DIONE
SpectraBase Compound ID FJFr80tUFMs
InChI InChI=1S/C10H9NO3/c12-9-2-1-7-10(13)6-3-4-14-8(6)5-11(7)9/h3-4,7H,1-2,5H2/t7-/m0/s1
InChIKey BNLFKOFKPWDDLQ-ZETCQYMHSA-N
Mol Weight 191.19 g/mol
Molecular Formula C10H9NO3
Exact Mass 191.058243 g/mol
Enantiomer InChIKey BNLFKOFKPWDDLQ-SSDOTTSWSA-N
Racemate InChIKey BNLFKOFKPWDDLQ-UHFFFAOYSA-N