Wiley SpectraBase; SpectraBase Compound ID=EUURC0ecp0y
http://spectrabase.com/compound/EUURC0ecp0y (accessed Aug 07, 2020).

(4R,4AS)-(+)-4-HYDROXY-4,4A,5,6,7,9-HEXAHYDRO-FURO-[2,3-F]-INDOLIZIN-7-ONE
SpectraBase Compound ID EUURC0ecp0y
InChI InChI=1S/C10H11NO3/c12-9-2-1-7-10(13)6-3-4-14-8(6)5-11(7)9/h3-4,7,10,13H,1-2,5H2/t7-,10+/m0/s1
InChIKey GGYSUOHHSLYSHY-OIBJUYFYSA-N
Mol Weight 193.2 g/mol
Molecular Formula C10H11NO3
Exact Mass 193.073893 g/mol
Enantiomer InChIKey GGYSUOHHSLYSHY-XCBNKYQSSA-N