Wiley SpectraBase; SpectraBase Compound ID=C8RtvOl56pO
http://spectrabase.com/compound/C8RtvOl56pO (accessed Aug 07, 2020).

(4R,4AS)-(+)-4-HYDROXY-4,4A,5,6,7,9-HEXAHYDROTHIENO-[2,3-F]-INDOLIZINE-7-ONE
SpectraBase Compound ID C8RtvOl56pO
InChI InChI=1S/C10H11NO2S/c12-9-2-1-7-10(13)6-3-4-14-8(6)5-11(7)9/h3-4,7,10,13H,1-2,5H2/t7-,10+/m0/s1
InChIKey XDFGKFSIVKZXKJ-OIBJUYFYSA-N
Mol Weight 209.26 g/mol
Molecular Formula C10H11NO2S
Exact Mass 209.05105 g/mol
Enantiomer InChIKey XDFGKFSIVKZXKJ-XCBNKYQSSA-N