Wiley SpectraBase; SpectraBase Compound ID=L8yuOceUdha
http://spectrabase.com/compound/L8yuOceUdha (accessed Aug 07, 2020).

(8AS,9S)-(+)-9-HYDROXY-4,6,7,8,8A,9-HEXAHYDRO-FURO-[3,2-F]-INDOLIZIN-6-ONE
SpectraBase Compound ID L8yuOceUdha
InChI InChI=1S/C10H11NO3/c12-8-2-1-7-9(13)10-6(3-4-14-10)5-11(7)8/h3-4,7,9,13H,1-2,5H2/t7-,9-/m0/s1
InChIKey JAEDHUVAJLRJRL-CBAPKCEASA-N
Mol Weight 193.2 g/mol
Molecular Formula C10H11NO3
Exact Mass 193.073893 g/mol
Enantiomer InChIKey JAEDHUVAJLRJRL-VXNVDRBHSA-N