| SpectraBase Spectrum ID |
DkSLSnrePXk |
| Name |
Testosterone |
| CAS Registry Number |
58-22-0 |
| Classification |
Pharmaceutical drug, androgenetic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (84) |
| DEA Controlled Substance Name |
testosterone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
288.208930140 u |
| Formula |
C19H28O2 |
| InChI |
InChI=1S/C19H28O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h11,14-17,21H,3-10H2,1-2H3/t14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey |
MUMGGOZAMZWBJJ-DYKIIFRCSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
288.431 g/mol |
| Nominal Mass |
288 u |
| Quality |
922 |
| Retention Index |
2348 |
| SMILES |
O[C@@]1([C@@]2([C@]([C@]3([C@@]([C@@]4(C(CC3)=CC(CC4)=O)C)(CC2)[H])[H])(CC1)[H])C)[H] |
| SPLASH |
splash10-05fs-3930000000-52af556051d17af4abc8 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
Androderm
Testoderm
(8R,9S,10R,13S,14S,17S)-17-Hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-\rdodecahydrocyclopenta[a]phenanthren-3-one |
| Technique |
GC/MS |
| Wiley ID |
DD2024_014036 |
