Wiley SpectraBase; SpectraBase Compound ID=eK1J2Z4fy5
http://spectrabase.com/compound/eK1J2Z4fy5 (accessed Aug 04, 2020).

SpectraBase Compound ID eK1J2Z4fy5
InChI InChI=1S/C12H18O3/c1-8(13)14-10-6-5-9-4-2-3-7-12(9)11(10)15-12/h9-11H,2-7H2,1H3/t9-,10-,11-,12+/m0/s1
Mol Weight 210.27 g/mol
Molecular Formula C12H18O3
Exact Mass 210.125595 g/mol