Wiley SpectraBase; SpectraBase Compound ID=H4Ra4Cp8J5
http://spectrabase.com/compound/H4Ra4Cp8J5 (accessed Aug 12, 2020).

XFGQENHIFIMGBM-NAKRPEOUSA-N
SpectraBase Compound ID H4Ra4Cp8J5
InChI InChI=1S/C11H18O2/c1-10-5-2-3-6-11(10)9(13-11)8(12)4-7-10/h8-9,12H,2-7H2,1H3/t8-,9-,10-,11-/m0/s1
InChIKey XFGQENHIFIMGBM-NAKRPEOUSA-N
Mol Weight 182.26 g/mol
Molecular Formula C11H18O2
Exact Mass 182.13068 g/mol
Enantiomer InChIKey XFGQENHIFIMGBM-GWOFURMSSA-N