Wiley SpectraBase; SpectraBase Compound ID=KZH6KiigGXE
http://spectrabase.com/compound/KZH6KiigGXE (accessed Oct 24, 2020).

6,8-DIMETHYL-3H-PHENOTHIAZIN-3-ONE
SpectraBase Compound ID KZH6KiigGXE
InChI InChI=1S/C14H11NOS/c1-8-5-9(2)14-12(6-8)15-11-4-3-10(16)7-13(11)17-14/h3-7H,1-2H3
InChIKey ZAABJDHRUUFKOL-UHFFFAOYSA-N
Mol Weight 241.31 g/mol
Molecular Formula C14H11NOS
Exact Mass 241.056136 g/mol