Wiley SpectraBase; SpectraBase Compound ID=AoYG0G40VUP
http://spectrabase.com/compound/AoYG0G40VUP (accessed Oct 27, 2020).

4-bromo-3H-phenothiazin-3-one
SpectraBase Compound ID AoYG0G40VUP
InChI InChI=1S/C12H6BrNOS/c13-11-9(15)6-5-8-12(11)16-10-4-2-1-3-7(10)14-8/h1-6H
InChIKey KPLILEWPOJHMFO-UHFFFAOYSA-N
Mol Weight 292.15 g/mol
Molecular Formula C12H6BrNOS
Exact Mass 290.935347 g/mol