Wiley SpectraBase; SpectraBase Compound ID=KLOPZ2UYBg7
http://spectrabase.com/compound/KLOPZ2UYBg7 (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID KLOPZ2UYBg7
InChI InChI=1S/C13H16N2O2/c14-12(16)10-7-4-8-11(10)15-13(17)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2,(H2,14,16)(H,15,17)/t10-,11-/m1/s1
InChIKey GTSOMGLWKDBWJA-GHMZBOCLSA-N
Mol Weight 232.28 g/mol
Molecular Formula C13H16N2O2
Exact Mass 232.121178 g/mol
Enantiomer InChIKey GTSOMGLWKDBWJA-QWRGUYRKSA-N