Wiley SpectraBase; SpectraBase Compound ID=JVxDJJrMEOX
http://spectrabase.com/compound/JVxDJJrMEOX (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID JVxDJJrMEOX
InChI InChI=1S/C6H7NO2/c1-5(7-8)6-3-2-4-9-6/h2-4,8H,1H3/b7-5-
InChIKey RCUXWEHXMOUJCX-ALCCZGGFSA-N
Mol Weight 125.13 g/mol
Molecular Formula C6H7NO2
Exact Mass 125.047679 g/mol