SpectraBase Compound ID | JP9xEqG6rfC |
---|---|
InChI | InChI=1S/C14H14N2S/c1-11-3-7-13(8-4-11)15-17-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
InChIKey | MRCQXBFPTAPZEA-UHFFFAOYSA-N |
Mol Weight | 242.34 g/mol |
Molecular Formula | C14H14N2S |
Exact Mass | 242.08777 g/mol |
Title | Journal or Book | Year |
---|---|---|
13C NMR spectra of someN-aryl substituted sulphur-nitrogen compounds | Organic Magnetic Resonance | 1976 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software