SpectraBase Compound ID | GXsR7RJY53t |
---|---|
InChI | InChI=1S/C12H8Cl2N2S/c13-9-1-5-11(6-2-9)15-17-16-12-7-3-10(14)4-8-12/h1-8H |
InChIKey | WLSSXCBGXXZGJI-UHFFFAOYSA-N |
Mol Weight | 283.18 g/mol |
Molecular Formula | C12H8Cl2N2S |
Exact Mass | 281.978526 g/mol |
Title | Journal or Book | Year |
---|---|---|
13C NMR spectra of someN-aryl substituted sulphur-nitrogen compounds | Organic Magnetic Resonance | 1976 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software