Wiley SpectraBase; SpectraBase Compound ID=IS9X8jTPDt6
http://spectrabase.com/compound/IS9X8jTPDt6 (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID IS9X8jTPDt6
InChI InChI=1S/C12H10N2O/c15-14-12(10-6-2-1-3-7-10)11-8-4-5-9-13-11/h1-9,15H/b14-12+
InChIKey RSJDEVMJZLLAHS-WYMLVPIESA-N
Mol Weight 198.22 g/mol
Molecular Formula C12H10N2O
Exact Mass 198.079313 g/mol