SpectraBase Compound ID | FPlvcXsEDg3 |
---|---|
InChI | InChI=1S/C14H24N2O4/c1-9(2)11(17)13(19)15-7-5-6-8-16-14(20)12(18)10(3)4/h5-12,17-18H,1-4H3,(H,15,19)(H,16,20)/b7-5-,8-6- |
InChIKey | VSUBZAVPZZDZOR-SFECMWDFSA-N |
Mol Weight | 284.36 g/mol |
Molecular Formula | C14H24N2O4 |
Exact Mass | 284.173607 g/mol |
Title | Journal or Book | Year |
---|---|---|
Metabolites from the endophytic fungus Phomopsis sp. PSU-D15 | Phytochemistry | 2008 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software