Wiley SpectraBase; SpectraBase Compound ID=EbYGiHVwOTp
http://spectrabase.com/compound/EbYGiHVwOTp (accessed Jul 15, 2020).

3-(4-BROMOPHENYL)-GLUTARIC-ANHYDRIDE
SpectraBase Compound ID EbYGiHVwOTp
InChI InChI=1S/C11H9BrO3/c12-9-3-1-7(2-4-9)8-5-10(13)15-11(14)6-8/h1-4,8H,5-6H2
InChIKey UVZKTNHKBFICNI-UHFFFAOYSA-N
Mol Weight 269.09 g/mol
Molecular Formula C11H9BrO3
Exact Mass 267.973505 g/mol