Wiley SpectraBase; SpectraBase Compound ID=7FEZihxRAU2
http://spectrabase.com/compound/7FEZihxRAU2 (accessed Sep 25, 2020).

SpectraBase Compound ID 7FEZihxRAU2
InChI InChI=1S/C11H9FO3/c12-9-3-1-7(2-4-9)8-5-10(13)15-11(14)6-8/h1-4,8H,5-6H2
Mol Weight 208.19 g/mol
Molecular Formula C11H9FO3
Exact Mass 208.053573 g/mol