Wiley SpectraBase; SpectraBase Compound ID=CooDmdDUBD0
http://spectrabase.com/compound/CooDmdDUBD0 (accessed Jul 15, 2020).

SpectraBase Compound ID CooDmdDUBD0
InChI InChI=1S/C14H12N2O4S/c1-15-11(17)9(12(18)16(2)14(15)21)10-7-5-3-4-6-8(7)13(19)20-10/h3-6,9-10H,1-2H3
Mol Weight 304.32 g/mol
Molecular Formula C14H12N2O4S
Exact Mass 304.051779 g/mol