Wiley SpectraBase; SpectraBase Compound ID=3W2xmCj2Ryn
http://spectrabase.com/compound/3W2xmCj2Ryn (accessed Jul 15, 2020).

SpectraBase Compound ID 3W2xmCj2Ryn
InChI InChI=1S/C17H10O4/c18-14-9-5-1-2-6-10(9)15(19)13(14)16-11-7-3-4-8-12(11)17(20)21-16/h1-8,13,16H
Mol Weight 278.26 g/mol
Molecular Formula C17H10O4
Exact Mass 278.057909 g/mol