Wiley SpectraBase; SpectraBase Compound ID=AlsK5sHrPWH
http://spectrabase.com/compound/AlsK5sHrPWH (accessed Aug 07, 2020).

7-BUTYL-6,8-DIHYDROXY-3(R)-PENT-11-ENYLISOCHROMAN-1-ONE
SpectraBase Compound ID AlsK5sHrPWH
InChI InChI=1S/C18H24O4/c1-3-5-7-8-13-10-12-11-15(19)14(9-6-4-2)17(20)16(12)18(21)22-13/h3,5,11,13,19-20H,4,6-10H2,1-2H3/b5-3+/t13-/m1/s1
InChIKey RNIKQZXKWIZFHL-MASHWEEQSA-N
Mol Weight 304.39 g/mol
Molecular Formula C18H24O4
Exact Mass 304.167459 g/mol
Enantiomer InChIKey RNIKQZXKWIZFHL-LQPUYASZSA-N
Racemate InChIKey RNIKQZXKWIZFHL-HWKANZROSA-N