Wiley SpectraBase; SpectraBase Compound ID=2BGeL6jFz3y
http://spectrabase.com/compound/2BGeL6jFz3y (accessed Aug 07, 2020).

CJ-12,373
SpectraBase Compound ID 2BGeL6jFz3y
InChI InChI=1S/C17H24O6/c1-2-3-4-5-6-7-11-8-10-9-12(18)14(16(20)21)15(19)13(10)17(22)23-11/h9,11,17-19,22H,2-8H2,1H3,(H,20,21)/t11-,17-/m0/s1
InChIKey PTQJWIMJHPBXTF-GTNSWQLSSA-N
Mol Weight 324.37 g/mol
Molecular Formula C17H24O6
Exact Mass 324.157289 g/mol
Enantiomer InChIKey PTQJWIMJHPBXTF-PIGZYNQJSA-N