Wiley SpectraBase; SpectraBase Compound ID=9KmSi9Wq0Mx
http://spectrabase.com/compound/9KmSi9Wq0Mx (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID 9KmSi9Wq0Mx
InChI InChI=1S/C13H14N2O/c14-9-11-7-4-8-12(11)15-13(16)10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-8H2,(H,15,16)/t11-,12+/m0/s1
InChIKey AWVSUGIQUMUIQO-NWDGAFQWSA-N
Mol Weight 214.27 g/mol
Molecular Formula C13H14N2O
Exact Mass 214.110613 g/mol
Enantiomer InChIKey AWVSUGIQUMUIQO-NEPJUHHUSA-N