SpectraBase Compound ID | 8k28DdTpIgY |
---|---|
InChI | InChI=1S/C12H4Cl6O/c13-5-1-3-6(4-2-5)19-12-10(17)8(15)7(14)9(16)11(12)18/h1-4H |
InChIKey | MXDRLBNLTLOWGV-UHFFFAOYSA-N |
Mol Weight | 376.9 g/mol |
Molecular Formula | C12H4Cl6O |
Exact Mass | 373.839331 g/mol |
Title | Journal or Book | Year |
---|---|---|
Carbon-13 nuclear magnetic resonance spectroscopy of polychlorinated diphenyl ethers | Organic Magnetic Resonance | 1977 |
Search your unknown spectrum against the world's largest collection of reference spectra
Offers every student and faculty member unlimited access to millions of spectra and advanced software