Wiley SpectraBase; SpectraBase Compound ID=7XYuHMALoxq
http://spectrabase.com/compound/7XYuHMALoxq (accessed Jul 14, 2020).

(1S,2S)-2-HYDROXYCYCLOHEXANECARBONITRILE
SpectraBase Compound ID 7XYuHMALoxq
InChI InChI=1S/C7H11NO/c8-5-6-3-1-2-4-7(6)9/h6-7,9H,1-4H2/t6-,7-/m0/s1
InChIKey MFPCXQNVYPKUSM-BQBZGAKWSA-N
Mol Weight 125.17 g/mol
Molecular Formula C7H11NO
Exact Mass 125.084064 g/mol
Enantiomer InChIKey MFPCXQNVYPKUSM-RNFRBKRXSA-N