Wiley SpectraBase; SpectraBase Compound ID=7Nok796GWxQ
http://spectrabase.com/compound/7Nok796GWxQ (accessed Oct 27, 2020).

NITROETHEN
SpectraBase Compound ID 7Nok796GWxQ
InChI InChI=1S/C2H3NO2/c1-2-3(4)5/h2H,1H2
InChIKey RPMXALUWKZHYOV-UHFFFAOYSA-N
Mol Weight 73.051 g/mol
Molecular Formula C2H3NO2
Exact Mass 73.016378 g/mol