Wiley SpectraBase; SpectraBase Compound ID=6B46zjyEOSt
http://spectrabase.com/compound/6B46zjyEOSt (accessed Oct 24, 2020).

(E)-1-nitroprop-1-ene
SpectraBase Compound ID 6B46zjyEOSt
InChI InChI=1S/C3H5NO2/c1-2-3-4(5)6/h2-3H,1H3/b3-2+
InChIKey RIHXMHKNTLBIPJ-NSCUHMNNSA-N
Mol Weight 87.08 g/mol
Molecular Formula C3H5NO2
Exact Mass 87.032028 g/mol