Wiley SpectraBase; SpectraBase Compound ID=3SyJZU2Rpgr
http://spectrabase.com/compound/3SyJZU2Rpgr (accessed Jul 14, 2020).

REFERENCE
SpectraBase Compound ID 3SyJZU2Rpgr
InChI InChI=1S/C6H11NO2/c7-5-3-1-2-4(5)6(8)9/h4-5H,1-3,7H2,(H,8,9)/t4-,5+/m1/s1
InChIKey JWYOAMOZLZXDER-UHNVWZDZSA-N
Mol Weight 129.16 g/mol
Molecular Formula C6H11NO2
Exact Mass 129.078979 g/mol
Enantiomer InChIKey JWYOAMOZLZXDER-CRCLSJGQSA-N