Wiley SpectraBase; SpectraBase Compound ID=3P7TBqCYjVt
http://spectrabase.com/compound/3P7TBqCYjVt (accessed Jul 11, 2020).

REFERENCE
SpectraBase Compound ID 3P7TBqCYjVt
InChI InChI=1S/C6H12N2O/c7-5-3-1-2-4(5)6(8)9/h4-5H,1-3,7H2,(H2,8,9)/t4-,5+/m1/s1
InChIKey FUGFTUCRJJFPES-UHNVWZDZSA-N
Mol Weight 128.17 g/mol
Molecular Formula C6H12N2O
Exact Mass 128.094963 g/mol
Enantiomer InChIKey FUGFTUCRJJFPES-CRCLSJGQSA-N