Wiley SpectraBase; SpectraBase Compound ID=2HvgtstAZf
http://spectrabase.com/compound/2HvgtstAZf (accessed Oct 25, 2020).

(1-S,2-R,5-R,6-S,7-S,8-S,10-R)-6-HYDROXY-2-ETHOXY-4-OXOPSEUDOGUAI-11-(13)-EN-12,8-OLIDE
SpectraBase Compound ID 2HvgtstAZf
InChI InChI=1S/C17H24O5/c1-5-21-11-7-12(18)17(4)14(11)8(2)6-10-13(15(17)19)9(3)16(20)22-10/h8,10-11,13-15,19H,3,5-7H2,1-2,4H3/t8-,10+,11-,13-,14-,15+,17-/m1/s1
InChIKey YXYLQALWYQEJAY-LAMAJPJRSA-N
Mol Weight 308.37 g/mol
Molecular Formula C17H24O5
Exact Mass 308.162374 g/mol
Enantiomer InChIKey YXYLQALWYQEJAY-WZTFACEDSA-N