Wiley SpectraBase; SpectraBase Compound ID=HOiLw2UygP
http://spectrabase.com/compound/HOiLw2UygP (accessed Aug 08, 2020).

HELENALIN-ACETATE
SpectraBase Compound ID HOiLw2UygP
InChI InChI=1S/C17H20O5/c1-8-7-12-14(9(2)16(20)22-12)15(21-10(3)18)17(4)11(8)5-6-13(17)19/h5-6,8,11-12,14-15H,2,7H2,1,3-4H3
InChIKey DCNRYQODUSSOKC-UHFFFAOYSA-N
Mol Weight 304.34 g/mol
Molecular Formula C17H20O5
Exact Mass 304.131074 g/mol