Wiley SpectraBase; SpectraBase Compound ID=1d91owxWXL
http://spectrabase.com/compound/1d91owxWXL (accessed Oct 29, 2020).

3-ETHENYL-4-METHYL-CYCLOHEX-2-EN-1-ONE
SpectraBase Compound ID 1d91owxWXL
InChI InChI=1S/C9H12O/c1-3-8-6-9(10)5-4-7(8)2/h3,6-7H,1,4-5H2,2H3
InChIKey JRVUUCDHLCLUMJ-UHFFFAOYSA-N
Mol Weight 136.19 g/mol
Molecular Formula C9H12O
Exact Mass 136.088815 g/mol