Wiley SpectraBase; SpectraBase Compound ID=HYoKwTqw0Gd
http://spectrabase.com/compound/HYoKwTqw0Gd (accessed Oct 24, 2020).

(E)-3-(3-keto-1-cyclohexenyl)acrolein
SpectraBase Compound ID HYoKwTqw0Gd
InChI InChI=1S/C9H10O2/c10-6-2-4-8-3-1-5-9(11)7-8/h2,4,6-7H,1,3,5H2/b4-2+
InChIKey BMIGEPQYQCUMGG-DUXPYHPUSA-N
Mol Weight 150.18 g/mol
Molecular Formula C9H10O2
Exact Mass 150.06808 g/mol