Wiley SpectraBase; SpectraBase Compound ID=1TViM6Y9dn
http://spectrabase.com/compound/1TViM6Y9dn (accessed Oct 25, 2020).

3-EPI-HYACINTHACINE-A1
SpectraBase Compound ID 1TViM6Y9dn
InChI InChI=1S/C8H15NO3/c10-4-6-8(12)7(11)5-2-1-3-9(5)6/h5-8,10-12H,1-4H2/t5-,6+,7+,8-/m1/s1
InChIKey STFSMGASTIYWRS-VGRMVHKJSA-N
Mol Weight 173.21 g/mol
Molecular Formula C8H15NO3
Exact Mass 173.105193 g/mol
Enantiomer InChIKey STFSMGASTIYWRS-OSMVPFSASA-N