| SpectraBase Spectrum ID |
pIjRmnb3mT |
| Name |
L-Glutamic acid di-tert-butyl ester hydrochloride |
| Source of Sample |
Alfa Aesar, Thermo Fisher Scientific |
| Catalog Number |
H63708 |
| Lot Number |
Z21C044 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
1 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
1 |
| Analog Signal 1 |
0.222536 |
| Analog Signal 2 |
0 |
| Aperture Setting |
2.5 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Backward Peak Amplitude |
2042 |
| Backward Peak Location |
28691 |
| Beam Splitter Setting |
Quartz |
| CAS Registry Number |
32677-01-3 |
| Calibration Lamp Spectrum |
Correction.0 |
| Color Properties |
White |
| Container ID |
C-009803 |
| Copyright |
Copyright © 2017-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
15 s |
| Detector Setting |
LN-Ge Diode [Internal Pos.2] |
| End Frequency Limit for File |
9394.3 |
| External Analog Signals |
Off |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C13H26ClNO4 |
| Frequency of First Point |
3597.79 cm⁻¹ |
| Frequency of Last Point |
-1.31092 cm⁻¹ |
| High Folding Limit |
31596.8 |
| High Frequency Limit |
30000 cm⁻¹ |
| High Pass Filter |
1 |
| InChI |
InChI=1S/C13H25NO4.ClH/c1-12(2,3)17-10(15)8-7-9(14)11(16)18-13(4,5)6;/h9H,7-8,14H2,1-6H3;1H/t9-;/m0./s1 |
| InChIKey |
LFEYMWCCUAOUKZ-FVGYRXGTSA-N |
| Instrument Name |
Bruker MultiRAM Stand Alone FT-Raman Spectrometer |
| Laser Wavenumber |
15798.4 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
5 |
| Measurement Channel |
Raman Compartment |
| Non Linearity Correction |
0 |
| Number of Points |
7466 |
| Number of Sample Scans |
64 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
1998 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
28693 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
power spectrum |
| Phase Resolution |
1 |
| Physical State |
Liquid |
| Preamplifier Gain |
0 |
| Purity |
98% |
| Raman Background Corrected |
Yes |
| Raman Corrections |
Referenced to internal light source; Scattering corrected |
| Raman Laser Source |
Nd:YAG |
| Raman Scattering Corrected |
Yes |
| Relative Humidity Interferometer |
30 % |
| Resolution |
2 |
| SKU |
H63708-1G |
| SMILES |
Cl.N[C@@](CCC(OC(C)(C)C)=O)(C(OC(C)(C)C)=O)[H] |
| Sample Scans or Time |
Scans |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
2 |
| Scan Time |
790.313 s |
| Scanner Temperature |
26.9 °C |
| Scanner Velocity |
5 kHz |
| Signal Gain, Sample |
2 |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
5794.76 cm⁻¹ |
| Start Time |
1.53184e+09 s |
| Synonyms |
L-Glutamic acid bis-tert-butyl ester hydrochloride |
| Technique |
FT-Raman |
| Zero Filling Factor |
4 |
