| SpectraBase Spectrum ID |
pHJc3ihrk |
| Name |
(6-(10H-phenothiazin-2-yl)pyridin-3-yl)(10H-pheno-thiazin-2-yl)methanone |
| Appearance |
Dark brown crystals |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C30H19N3OS2 |
| InChI |
InChI=1S/C30H19N3OS2/c34-30(19-11-14-29-25(16-19)33-23-6-2-4-8-27(23)36-29)20-9-12-21(31-17-20)18-10-13-28-24(15-18)32-22-5-1-3-7-26(22)35-28/h1-17,32-33H |
| InChIKey |
WVWKEMJRVLALQX-UHFFFAOYSA-N |
| Instrument Name |
Kratos and Varian MAT 311A |
| Ionization Type |
EI |
| Literature Reference DOI |
10.1002/jhet.3771 |
| Molecular Weight |
501.622 g/mol |
| SMILES |
N1c2ccccc2Sc2c1cc(C(c1cnc(-c3cc4c(cc3)Sc3ccccc3N4)cc1)=O)cc2 |
| SPLASH |
splash10-0a4i-9000000000-f3644ddde874671631bf |
| Source of Spectrum |
Y-57-263-7 |
| Thin-Layer Chromatography |
Rf = 0.74, (PE (40-60): EtOAc, 4:2) |
| Wiley ID |
1859781 |
