| SpectraBase Spectrum ID |
dfLAskgzY |
| Name |
Methyl 4,6-dimethoxy-1H-indole-2-carboxylate |
| Appearance |
White solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C12H13NO4 |
| InChI |
InChI=1S/C12H13NO4/c1-15-7-4-9-8(11(5-7)16-2)6-10(13-9)12(14)17-3/h4-6,13H,1-3H3 |
| InChIKey |
TVUJONIYWNBWPM-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
235.239 g/mol |
| Reported Formula |
C12H13NO4 |
| SMILES |
[nH]1c2c(cc1C(OC)=O)c(cc(c2)OC)OC |
| SPLASH |
splash10-0xy1-1940000000-d38f2a929ae29b61e97b |
| Source of Spectrum |
ARK-2014-40-1c |
| Thin-Layer Chromatography |
Rf = 0.65 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843222 |
