| SpectraBase Spectrum ID |
LfP85q9TwN1 |
| Name |
(2S,5R/S)-1-(tert-Butoxycarbonyl)-5-vinylpyrrolidine-2-carboxylic acid tert-butyl ester |
| Appearance |
Yellowish oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H27NO4 |
| InChI |
InChI=1S/C16H27NO4/c1-8-11-9-10-12(13(18)20-15(2,3)4)17(11)14(19)21-16(5,6)7/h8,11-12H,1,9-10H2,2-7H3/t11?,12-/m0/s1 |
| InChIKey |
UXJDZAJGGXHSSR-KIYNQFGBSA-N |
| Instrument Name |
Finnigan MAT Incos 50 Galaxy |
| Ionization Type |
EI |
| Molecular Weight |
297.395 g/mol |
| Optical Rotation |
[a]D20 = -54.6 (c = 0.935, CHCl3) |
| SMILES |
[C@]1(N(C(CC1)C=C)C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)[H] |
| SPLASH |
splash10-052e-9700000000-178cbec9ea447a72514e |
| Sample Comments |
mixture of epimers |
| Source of Spectrum |
US20110034438A1 |
| Thin-Layer Chromatography |
Rf = 0.24 (SiO2, EE/CH, 1:7) |
| Wiley ID |
1861638 |
