| SpectraBase Spectrum ID |
LIN4u183Hc3 |
| Name |
(R)-α-Lipoic acid |
| Source of Sample |
TCI America |
| Catalog Number |
L0207 |
| Lot Number |
QIKWG |
| Accessory |
DurasamplIR II |
| Apodization Function |
Norton-Beer, medium |
| CAS Registry Number |
1200-22-2 |
| Copyright |
Copyright © 2019-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C8H14O2S2 |
| InChI |
InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10)/t7-/m1/s1 |
| InChIKey |
AGBQKNBQESQNJD-SSDOTTSWSA-N |
| Instrument Name |
Bio-Rad FTS |
| Molecular Weight |
206.318 g/mol |
| Purity |
>98% |
| SMILES |
OC(CCCC[C@@]1(CCSS1)[H])=O |
| Scan Speed (number) |
5 |
| Source of Spectrum |
Forensic Spectral Research |
| Synonyms |
(R)-Thioctic acid; (R)-1,2-Dithiolane-3-valeric acid |
| Technique |
ATR-Neat |
