| SpectraBase Compound ID | B80XWabzgeD |
|---|---|
| InChI | InChI=1S/C8ClF15O/c9-1(25)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24 |
| InChIKey | AQQBRCXWZZAFOK-UHFFFAOYSA-N |
| Mol Weight | 432.52 g/mol |
| Molecular Formula | C8ClF15O |
| Exact Mass | 431.939815 g/mol |
Mass Spectrum (GC)
View the Full Spectrum for FREE!
The full spectrum can only be viewed using a FREE account.
| SpectraBase Spectrum ID | L8w4fYx7N3C |
|---|---|
| Name | Octanoyl chloride, pentadecafluoro- |
| CAS Registry Number | 335-64-8 |
| Copyright | Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula | C8ClF15O |
| InChI | InChI=1S/C8ClF15O/c9-1(25)2(10,11)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)24 |
| InChIKey | AQQBRCXWZZAFOK-UHFFFAOYSA-N |
| Molecular Weight | 432.516 g/mol |
| SMILES | C(=O)(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)Cl |
| SPLASH | splash10-02t9-9400000000-8cac19531876964bcb35 |
| Source of Spectrum | O-11-1218-1 |
| Synonyms | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-Pentadecafluorooctanoyl chloride 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorocaprylyl chloride 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecakis(fluoranyl)octanoyl chloride n-Perfluorooctanoyl chloride Pentadecafluorooctanoyl chloride Pentadecafluorooctyl chloride Perfluorocaprylic chloride Perfluorooctanoic acid chloride Perfluorooctanoyl chloride EINECS 206-394-2 |
| Wiley ID | 1382042 |