| SpectraBase Spectrum ID |
L8dzb5Fi4en |
| Name |
Trimeprazine |
| CAS Registry Number |
84-96-8 |
| Collision Energy |
25 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
298.150369890 u |
| Formula |
C18H22N2S |
| InChI |
InChI=1S/C18H22N2S/c1-14(12-19(2)3)13-20-15-8-4-6-10-17(15)21-18-11-7-5-9-16(18)20/h4-11,14H,12-13H2,1-3H3 |
| InChIKey |
ZZHLYYDVIOPZBE-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
298.448 g/mol |
| Nominal Mass |
298 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
299.158 |
| SMILES |
C=12SC=3C(N(C2=CC=CC1)CC(CN(C)C)C)=CC=CC3 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
N,N,2-trimethyl-3-phenothiazin-10-ylpropan-1-amine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_840.4 |