| SpectraBase Spectrum ID |
L2YLGvdVQ5l |
| Name |
Carbamazepine |
| CAS Registry Number |
298-46-4 |
| Collision Energy |
10 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
236.094963013 u |
| Formula |
C15H12N2O |
| InChI |
InChI=1S/C15H12N2O/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H,(H2,16,18) |
| InChIKey |
FFGPTBGBLSHEPO-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
236.274 g/mol |
| Nominal Mass |
236 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
237.102 |
| SMILES |
NC(N1C=2C(C=CC=3C1=CC=CC3)=CC=CC2)=O |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
5H-Dibenz[b,f]azepine-5-carboxamide |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_164.1 |
