| SpectraBase Spectrum ID |
Kyv6sIFjawT |
| Name |
4-Chloro-17alpha-methyltestosterone TMS |
| Classification |
Pharmaceutical drug derivative |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (18) |
| DEA Controlled Substance Name |
4-chloro-17α-methyl-17β-hydroxy-androst-4-en-3-one |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
408.225134664 u |
| Formula |
C23H37ClO2Si |
| InChI |
InChI=1S/C23H37ClO2Si/c1-21-12-11-19(25)20(24)18(21)8-7-15-16(21)9-13-22(2)17(15)10-14-23(22,3)26-27(4,5)6/h15-17H,7-14H2,1-6H3/t15-,16+,17+,21-,22+,23+/m1/s1 |
| InChIKey |
ACGIFTKOIPOCSO-BESJYZOMSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
409.085 g/mol |
| Nominal Mass |
408 u |
| Quality |
996 |
| Retention Index |
2958 |
| SMILES |
[C@@]12([C@]3([C@@]([C@](CC3)(O[Si](C)(C)C)C)(CC[C@@]1([C@@]1(C(CC2)=C(C(CC1)=O)Cl)C)[H])C)[H])[H] |
| SPLASH |
splash10-0006-6911000000-0d0cc4a0403167ca91c3 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(1S,3aS,3bR,9aR,9bS,11aS)-6-chloro-1,9a,11a-trimethyl-1-((trimethylsilyl)oxy)-1,2,3,3a,3b,4,5,8,9,9a,9b,10,11,11a-tetradecahydro-7H-cyclopenta[a]phenanthren-7-one |
| Technique |
GC/MS |
| Wiley ID |
DD2024_035063 |
