| SpectraBase Spectrum ID |
KtK1ir5BhFR |
| Name |
Methoxymethyl-methyl-phenyl-amine |
| Appearance |
Colourless liquid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C9H13NO |
| InChI |
InChI=1S/C9H13NO/c1-10(8-11-2)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey |
WYCRSCSOXFMGCE-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
151.209 g/mol |
| SMILES |
COCN(c1ccccc1)C |
| SPLASH |
splash10-00di-2900000000-5fcec059cec805eb87bd |
| Source of Spectrum |
ARK-2005-163-16 |
| Thin-Layer Chromatography |
Rf = 0.32 (diethyl ether/petroleum ether, 1:6) |
| Wiley ID |
1871027 |
