| SpectraBase Spectrum ID |
KP7HxZ3XadW |
| Name |
(2S,5R/S)-5-Allyl-1-(tert-butoxycarbonyl)pyrrolidine-2-carboxylic acid ethyl ester |
| Appearance |
Colorless oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C15H25NO4 |
| InChI |
InChI=1S/C15H25NO4/c1-6-8-11-9-10-12(13(17)19-7-2)16(11)14(18)20-15(3,4)5/h6,11-12H,1,7-10H2,2-5H3/t11?,12-/m0/s1 |
| InChIKey |
URAHNOIUACWUPU-KIYNQFGBSA-N |
| Instrument Name |
Finnigan MAT Incos 50 Galaxy |
| Ionization Type |
EI |
| Molecular Weight |
283.368 g/mol |
| Optical Rotation |
[a]D20 = -26.4 (c = 1.025, CHCl3) |
| SMILES |
[C@]1(N(C(CC1)CC=C)C(=O)OC(C)(C)C)(C(=O)OCC)[H] |
| SPLASH |
splash10-0006-4900000000-cbadbabb0914c62e034b |
| Sample Comments |
mixture of epimers, cis/trans (4:1), cis/trans (4:1) |
| Source of Spectrum |
US20110034438A1 |
| Thin-Layer Chromatography |
Rf = 0.39 (SiO2, EE/CH, 1:3) |
| Wiley ID |
1861633 |
