| SpectraBase Spectrum ID |
KNrantUqNTA |
| Name |
Phenacaine |
| CAS Registry Number |
101-93-9 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
298.168127954 u |
| Formula |
C18H22N2O2 |
| InChI |
InChI=1S/C18H22N2O2/c1-4-21-17-10-6-15(7-11-17)19-14(3)20-16-8-12-18(13-9-16)22-5-2/h6-13H,4-5H2,1-3H3,(H,19,20) |
| InChIKey |
QXDAEKSDNVPFJG-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
298.386 g/mol |
| Nominal Mass |
298 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
299.175 |
| SMILES |
N(C1=CC=C(OCC)C=C1)\C(=N\C1=CC=C(OCC)C=C1)C |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
N,N'-bis(4-ethoxyphenyl)ethanimidamide |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_720.6 |