| SpectraBase Spectrum ID |
KJxtcLd8H5k |
| Name |
(4RS)-(??)-1-Methyl-4-phenyl-1,2,3,4-tetrahydroquinoline |
| Appearance |
Colorless liquid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H17N |
| InChI |
InChI=1S/C16H17N/c1-17-12-11-14(13-7-3-2-4-8-13)15-9-5-6-10-16(15)17/h2-10,14H,11-12H2,1H3 |
| InChIKey |
MLIIQHPUWXQPBF-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
223.319 g/mol |
| SMILES |
CN1CCC(c2ccccc12)c1ccccc1 |
| SPLASH |
splash10-006x-5960000000-aa7cd3cd268d9464406c |
| Source of Spectrum |
ARK-2005-165-37 |
| Thin-Layer Chromatography |
Rf = 0.32 (diethyl ether/petroleum ether, 1:4) |
| Wiley ID |
1871030 |
