| SpectraBase Spectrum ID |
KGpoOFgGolC |
| Name |
Diisopentylamine |
| CAS Registry Number |
544-00-3 |
| Collision Energy |
30 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
157.183049745 u |
| Formula |
C10H23N |
| InChI |
InChI=1S/C10H23N/c1-9(2)5-7-11-8-6-10(3)4/h9-11H,5-8H2,1-4H3 |
| InChIKey |
SPVVMXMTSODFPU-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
157.301 g/mol |
| Nominal Mass |
157 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
158.19 |
| SMILES |
N(CCC(C)C)CCC(C)C |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
3-methyl-N-(3-methylbutyl)butan-1-amine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_290.5 |